C21H24O5 — CID 25157641
2-(5-cyclopentyl-2-hydroxy-3-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)ethanone (PubChem CID 25157641) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-(5-cyclopentyl-2-hydroxy-3-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)ethanone.
| Compound Name | 2-(5-cyclopentyl-2-hydroxy-3-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 25157641 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-(5-cyclopentyl-2-hydroxy-3-methoxyphenyl)-1-(4-hydroxy-3-methoxyphenyl)ethanone |
| SMILES | COc1cc(C(=O)Cc2cc(C3CCCC3)cc(OC)c2O)ccc1O |
| InChI | InChI=1S/C21H24O5/c1-25-19-11-14(7-8-17(19)22)18(23)10-16-9-15(13-5-3-4-6-13)12-20(26-2)21(16)24/h7-9,11-13,22,24H,3-6,10H2,1-2H3 |
| InChIKey | WFUXDALLCBZXQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |