C22H23F4N3O — CID 25159787
7-[[4-(4-fluorophenyl)piperidin-4-yl]methoxymethyl]-2-methyl-5-(trifluoromethyl)indazole (PubChem CID 25159787) has the molecular formula C22H23F4N3O and a molecular weight of 421.44 g/mol. Its IUPAC name is 7-[[4-(4-fluorophenyl)piperidin-4-yl]methoxymethyl]-2-methyl-5-(trifluoromethyl)indazole.
| Compound Name | 7-[[4-(4-fluorophenyl)piperidin-4-yl]methoxymethyl]-2-methyl-5-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 25159787 |
| Molecular Formula | C22H23F4N3O |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 7-[[4-(4-fluorophenyl)piperidin-4-yl]methoxymethyl]-2-methyl-5-(trifluoromethyl)indazole |
| SMILES | Cn1cc2cc(C(F)(F)F)cc(COCC3(c4ccc(F)cc4)CCNCC3)c2n1 |
| InChI | InChI=1S/C22H23F4N3O/c1-29-12-15-10-18(22(24,25)26)11-16(20(15)28-29)13-30-14-21(6-8-27-9-7-21)17-2-4-19(23)5-3-17/h2-5,10-12,27H,6-9,13-14H2,1H3 |
| InChIKey | NJKXKMUBCMBGHD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |