About cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one
cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one (PubChem CID 25163374) has the molecular formula C18H23N3O4S
and a molecular weight of 377.47 g/mol. Its IUPAC name is cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one |
| PubChem CID | 25163374 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one |
| SMILES | CC(=O)C[C@@H]1CCCC(=O)[C@@]1(CCCN=[N+]=[N-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O4S/c1-14(22)13-15-7-5-10-17(23)18(15,11-6-12-20-21-19)26(24,25)16-8-3-2-4-9-16/h2-4,8-9,15H,5-7,10-13H2,1H3/t15-,18-/m0/s1 |
| InChIKey | HUKBQSYGTBIJCS-YJBOKZPZSA-N |
| XLogP | 3.64 |
| TPSA | 117.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one?
The IUPAC name of cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one (CID 25163374) is cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one.
What is the SMILES notation for cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one?
The canonical SMILES for cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one is CC(=O)C[C@@H]1CCCC(=O)[C@@]1(CCCN=[N+]=[N-])S(=O)(=O)c1ccccc1.
What is the InChIKey of cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one?
The InChIKey is HUKBQSYGTBIJCS-YJBOKZPZSA-N. The full InChI is InChI=1S/C18H23N3O4S/c1-14(22)13-15-7-5-10-17(23)18(15,11-6-12-20-21-19)26(24,25)16-8-3-2-4-9-16/h2-4,8-9,15H,5-7,10-13H2,1H3/t15-,18-/m0/s1.
What are the key properties of cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one?
cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one has a molecular weight of 377.47 g/mol, XLogP of 3.64, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3S)-2-(3-azidopropyl)-2-(benzenesulfonyl)-3-(2-oxopropyl)cyclohexan-1-one is sourced from PubChem (CID 25163374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).