C19H25N3O4S — CID 134941732
2-(3-azidopropyl)-2-(benzenesulfonyl)-5-methyl-3-(2-oxopropyl)cyclohexan-1-one (PubChem CID 134941732) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-(3-azidopropyl)-2-(benzenesulfonyl)-5-methyl-3-(2-oxopropyl)cyclohexan-1-one.
| Compound Name | 2-(3-azidopropyl)-2-(benzenesulfonyl)-5-methyl-3-(2-oxopropyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134941732 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-(3-azidopropyl)-2-(benzenesulfonyl)-5-methyl-3-(2-oxopropyl)cyclohexan-1-one |
| SMILES | CC(=O)CC1CC(C)CC(=O)C1(CCCN=[N+]=[N-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-14-11-16(13-15(2)23)19(18(24)12-14,9-6-10-21-22-20)27(25,26)17-7-4-3-5-8-17/h3-5,7-8,14,16H,6,9-13H2,1-2H3 |
| InChIKey | GLHZWNJHZRCEBV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 117.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|