C21H17ClF3N5O3S — CID 25164936
6-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanyl-N-ethoxypyrimidine-4-carboxamide (PubChem CID 25164936) has the molecular formula C21H17ClF3N5O3S and a molecular weight of 511.91 g/mol. Its IUPAC name is 6-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanyl-N-ethoxypyrimidine-4-carboxamide.
| Compound Name | 6-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanyl-N-ethoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 25164936 |
| Molecular Formula | C21H17ClF3N5O3S |
| Molecular Weight | 511.91 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 6-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfanyl-N-ethoxypyrimidine-4-carboxamide |
| SMILES | CCONC(=O)c1cc(Sc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ncn1 |
| InChI | InChI=1S/C21H17ClF3N5O3S/c1-2-33-30-19(31)17-10-18(27-11-26-17)34-14-6-3-12(4-7-14)28-20(32)29-13-5-8-16(22)15(9-13)21(23,24)25/h3-11H,2H2,1H3,(H,30,31)(H2,28,29,32) |
| InChIKey | YVQQPBFLSSOXOU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.91 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|