C20H16ClF3N6O4 — CID 25165140
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-ethoxy-1,3,5-triazine-2-carboxamide (PubChem CID 25165140) has the molecular formula C20H16ClF3N6O4 and a molecular weight of 496.83 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-ethoxy-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-ethoxy-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 25165140 |
| Molecular Formula | C20H16ClF3N6O4 |
| Molecular Weight | 496.83 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-ethoxy-1,3,5-triazine-2-carboxamide |
| SMILES | CCONC(=O)c1ncnc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)n1 |
| InChI | InChI=1S/C20H16ClF3N6O4/c1-2-33-30-17(31)16-25-10-26-19(29-16)34-13-6-3-11(4-7-13)27-18(32)28-12-5-8-15(21)14(9-12)20(22,23)24/h3-10H,2H2,1H3,(H,30,31)(H2,27,28,32) |
| InChIKey | PIVUQKMVAQHRFM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|