C20H20N2O2S — CID 25165606
N-(2,3-dihydro-1-benzofuran-3-yl)-3-(2-methoxyethyl)-4-phenyl-1,3-thiazol-2-imine (PubChem CID 25165606) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-3-yl)-3-(2-methoxyethyl)-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | N-(2,3-dihydro-1-benzofuran-3-yl)-3-(2-methoxyethyl)-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 25165606 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-3-yl)-3-(2-methoxyethyl)-4-phenyl-1,3-thiazol-2-imine |
| SMILES | COCCn1c(-c2ccccc2)cs/c1=N\C1COc2ccccc21 |
| InChI | InChI=1S/C20H20N2O2S/c1-23-12-11-22-18(15-7-3-2-4-8-15)14-25-20(22)21-17-13-24-19-10-6-5-9-16(17)19/h2-10,14,17H,11-13H2,1H3/b21-20- |
| InChIKey | GRPCRLWNYMICTI-MRCUWXFGSA-N |
| XLogP | 3.90 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|