C22H29F3N6O5 — CID 25167849
2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]propane-1,3-diol (PubChem CID 25167849) has the molecular formula C22H29F3N6O5 and a molecular weight of 514.51 g/mol. Its IUPAC name is 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]propane-1,3-diol.
| Compound Name | 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 25167849 |
| Molecular Formula | C22H29F3N6O5 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]propane-1,3-diol |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)nc1NCC1CCC(NC(CO)CO)CC1 |
| InChI | InChI=1S/C22H29F3N6O5/c23-22(24,25)36-19-4-2-1-3-15(19)10-27-21-28-11-18(31(34)35)20(30-21)26-9-14-5-7-16(8-6-14)29-17(12-32)13-33/h1-4,11,14,16-17,29,32-33H,5-10,12-13H2,(H2,26,27,28,30) |
| InChIKey | HNKGKJIQTNPTRB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 154.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|