C22H20N6O6 — CID 2517036
1-ethyl-2-methyl-N'-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]benzimidazole-5-carbohydrazide (PubChem CID 2517036) has the molecular formula C22H20N6O6 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2517036 |
| Molecular Formula | C22H20N6O6 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-ethyl-2-methyl-N'-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]benzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)CCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)ccc21 |
| InChI | InChI=1S/C22H20N6O6/c1-3-26-12(2)23-15-11-13(7-8-16(15)26)20(30)25-24-18(29)9-10-27-21(31)14-5-4-6-17(28(33)34)19(14)22(27)32/h4-8,11H,3,9-10H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | OAZFQARGCOUSFU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|