C22H18N2O — CID 25170726
5-methyl-N,2-diphenylindole-1-carboxamide (PubChem CID 25170726) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-methyl-N,2-diphenylindole-1-carboxamide.
| Compound Name | 5-methyl-N,2-diphenylindole-1-carboxamide |
|---|---|
| PubChem CID | 25170726 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-methyl-N,2-diphenylindole-1-carboxamide |
| SMILES | Cc1ccc2c(c1)cc(-c1ccccc1)n2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N2O/c1-16-12-13-20-18(14-16)15-21(17-8-4-2-5-9-17)24(20)22(25)23-19-10-6-3-7-11-19/h2-15H,1H3,(H,23,25) |
| InChIKey | WHPJBUSYANZPAB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |