C18H16N2O2 — CID 57274159
5-cyclopropyl-2-hydroxy-N-phenylindole-1-carboxamide (PubChem CID 57274159) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-cyclopropyl-2-hydroxy-N-phenylindole-1-carboxamide.
| Compound Name | 5-cyclopropyl-2-hydroxy-N-phenylindole-1-carboxamide |
|---|---|
| PubChem CID | 57274159 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-cyclopropyl-2-hydroxy-N-phenylindole-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)n1c(O)cc2cc(C3CC3)ccc21 |
| InChI | InChI=1S/C18H16N2O2/c21-17-11-14-10-13(12-6-7-12)8-9-16(14)20(17)18(22)19-15-4-2-1-3-5-15/h1-5,8-12,21H,6-7H2,(H,19,22) |
| InChIKey | VWTSIPRXGAVNQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |