C22H15F3N2O — CID 25170544
N,2-diphenyl-5-(trifluoromethyl)indole-1-carboxamide (PubChem CID 25170544) has the molecular formula C22H15F3N2O and a molecular weight of 380.37 g/mol. Its IUPAC name is N,2-diphenyl-5-(trifluoromethyl)indole-1-carboxamide.
| Compound Name | N,2-diphenyl-5-(trifluoromethyl)indole-1-carboxamide |
|---|---|
| PubChem CID | 25170544 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N,2-diphenyl-5-(trifluoromethyl)indole-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)n1c(-c2ccccc2)cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H15F3N2O/c23-22(24,25)17-11-12-19-16(13-17)14-20(15-7-3-1-4-8-15)27(19)21(28)26-18-9-5-2-6-10-18/h1-14H,(H,26,28) |
| InChIKey | JJVUMGZYJSUABW-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |