C27H23N3O5 — CID 25177843
(19S)-19-ethyl-14,18-dioxo-7-(2-pyridin-1-ium-1-ylethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-olate (PubChem CID 25177843) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is (19S)-19-ethyl-14,18-dioxo-7-(2-pyridin-1-ium-1-ylethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-olate.
| Compound Name | (19S)-19-ethyl-14,18-dioxo-7-(2-pyridin-1-ium-1-ylethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-olate |
|---|---|
| PubChem CID | 25177843 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (19S)-19-ethyl-14,18-dioxo-7-(2-pyridin-1-ium-1-ylethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-19-olate |
| SMILES | CC[C@@]1([O-])C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OCC[n+]4ccccc4)ccc3nc2-1 |
| InChI | InChI=1S/C27H23N3O5/c1-2-27(33)21-14-23-24-18(15-30(23)25(31)20(21)16-35-26(27)32)12-17-13-19(6-7-22(17)28-24)34-11-10-29-8-4-3-5-9-29/h3-9,12-14H,2,10-11,15-16H2,1H3/t27-/m0/s1 |
| InChIKey | HBCLHSFHRHOTAT-MHZLTWQESA-N |
| XLogP | 1.81 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|