C23H25NO3 — CID 25178973
(3R,6R)-3-benzyl-6-(methoxymethyl)-6-methyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one (PubChem CID 25178973) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3R,6R)-3-benzyl-6-(methoxymethyl)-6-methyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one.
| Compound Name | (3R,6R)-3-benzyl-6-(methoxymethyl)-6-methyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one |
|---|---|
| PubChem CID | 25178973 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (3R,6R)-3-benzyl-6-(methoxymethyl)-6-methyl-5-phenyl-3-prop-2-enyl-1,4-oxazin-2-one |
| SMILES | C=CC[C@]1(Cc2ccccc2)N=C(c2ccccc2)[C@](C)(COC)OC1=O |
| InChI | InChI=1S/C23H25NO3/c1-4-15-23(16-18-11-7-5-8-12-18)21(25)27-22(2,17-26-3)20(24-23)19-13-9-6-10-14-19/h4-14H,1,15-17H2,2-3H3/t22-,23+/m0/s1 |
| InChIKey | QDKFRQKKTZBOSU-XZOQPEGZSA-N |
| XLogP | 4.00 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|