C15H16N2O2S — CID 25179252
S-prop-2-enyl 3-methyl-4-(2-methylphenyl)-5-oxo-1H-pyrazole-2-carbothioate (PubChem CID 25179252) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is S-prop-2-enyl 3-methyl-4-(2-methylphenyl)-5-oxo-1H-pyrazole-2-carbothioate.
| Compound Name | S-prop-2-enyl 3-methyl-4-(2-methylphenyl)-5-oxo-1H-pyrazole-2-carbothioate |
|---|---|
| PubChem CID | 25179252 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | S-prop-2-enyl 3-methyl-4-(2-methylphenyl)-5-oxo-1H-pyrazole-2-carbothioate |
| SMILES | C=CCSC(=O)n1[nH]c(=O)c(-c2ccccc2C)c1C |
| InChI | InChI=1S/C15H16N2O2S/c1-4-9-20-15(19)17-11(3)13(14(18)16-17)12-8-6-5-7-10(12)2/h4-8H,1,9H2,2-3H3,(H,16,18) |
| InChIKey | RQIAFBJPDOOATR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|