C29H31Cl2N3O10S — CID 25181539
5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione (PubChem CID 25181539) has the molecular formula C29H31Cl2N3O10S and a molecular weight of 684.55 g/mol. Its IUPAC name is 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione.
| Compound Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 25181539 |
| Molecular Formula | C29H31Cl2N3O10S |
| Molecular Weight | 684.55 g/mol |
| Exact Mass | 683.11 |
| IUPAC Name | 5-tert-butyl-3-(2,4-dichloro-5-propan-2-yloxyphenyl)-1,3,4-oxadiazol-2-one;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione |
| SMILES | CC(C)Oc1cc(-n2nc(C(C)(C)C)oc2=O)c(Cl)cc1Cl.CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18Cl2N2O3.C14H13NO7S/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5;1-23(21,22)8-5-6-9(10(7-8)15(19)20)14(18)13-11(16)3-2-4-12(13)17/h6-8H,1-5H3;5-7,13H,2-4H2,1H3 |
| InChIKey | SMXIAKXPWURKHB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 185.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|