C17H37N3O15P4 — CID 25185140
[2-[acetyl-[3-[acetyl-[4-[acetyl(2,2-diphosphonoethyl)amino]butyl]amino]propyl]amino]-1-phosphonoethyl]phosphonic acid (PubChem CID 25185140) has the molecular formula C17H37N3O15P4 and a molecular weight of 647.38 g/mol. Its IUPAC name is [2-[acetyl-[3-[acetyl-[4-[acetyl(2,2-diphosphonoethyl)amino]butyl]amino]propyl]amino]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[acetyl-[3-[acetyl-[4-[acetyl(2,2-diphosphonoethyl)amino]butyl]amino]propyl]amino]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25185140 |
| Molecular Formula | C17H37N3O15P4 |
| Molecular Weight | 647.38 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | [2-[acetyl-[3-[acetyl-[4-[acetyl(2,2-diphosphonoethyl)amino]butyl]amino]propyl]amino]-1-phosphonoethyl]phosphonic acid |
| SMILES | CC(=O)N(CCCCN(CC(P(=O)(O)O)P(=O)(O)O)C(C)=O)CCCN(CC(P(=O)(O)O)P(=O)(O)O)C(C)=O |
| InChI | InChI=1S/C17H37N3O15P4/c1-13(21)18(9-6-10-20(15(3)23)12-17(38(30,31)32)39(33,34)35)7-4-5-8-19(14(2)22)11-16(36(24,25)26)37(27,28)29/h16-17H,4-12H2,1-3H3,(H2,24,25,26)(H2,27,28,29)(H2,30,31,32)(H2,33,34,35) |
| InChIKey | UEVNUDKUIZKFKF-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 291.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.38 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|