C21H23N5O2S — CID 25188529
9H-fluoren-9-ylmethyl N-[(2S)-4-methylsulfanyl-1-(tetrazol-1-yl)butan-2-yl]carbamate (PubChem CID 25188529) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-methylsulfanyl-1-(tetrazol-1-yl)butan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-methylsulfanyl-1-(tetrazol-1-yl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 25188529 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-methylsulfanyl-1-(tetrazol-1-yl)butan-2-yl]carbamate |
| SMILES | CSCC[C@@H](Cn1cnnn1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H23N5O2S/c1-29-11-10-15(12-26-14-22-24-25-26)23-21(27)28-13-20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20/h2-9,14-15,20H,10-13H2,1H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | AQWYIEYVZKXAFX-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |