C18H17N5O2 — CID 25188524
9H-fluoren-9-ylmethyl N-[2-(tetrazol-1-yl)ethyl]carbamate (PubChem CID 25188524) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-(tetrazol-1-yl)ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-(tetrazol-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 25188524 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-(tetrazol-1-yl)ethyl]carbamate |
| SMILES | O=C(NCCn1cnnn1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H17N5O2/c24-18(19-9-10-23-12-20-21-22-23)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17H,9-11H2,(H,19,24) |
| InChIKey | AJEMNTVOSJXHII-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |