C22H25N5O2 — CID 25185203
9H-fluoren-9-ylmethyl N-[(2S,3S)-3-methyl-1-(tetrazol-1-yl)pentan-2-yl]carbamate (PubChem CID 25185203) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S,3S)-3-methyl-1-(tetrazol-1-yl)pentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-3-methyl-1-(tetrazol-1-yl)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 25185203 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S,3S)-3-methyl-1-(tetrazol-1-yl)pentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@@H](Cn1cnnn1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H25N5O2/c1-3-15(2)21(12-27-14-23-25-26-27)24-22(28)29-13-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,14-15,20-21H,3,12-13H2,1-2H3,(H,24,28)/t15-,21+/m0/s1 |
| InChIKey | XWKSDKOZGOVVNQ-YCRPNKLZSA-N |
| XLogP | 3.63 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |