C16H13F3N2O2 — CID 25188824
3-methyl-1-(4-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydroindole (PubChem CID 25188824) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 3-methyl-1-(4-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydroindole.
| Compound Name | 3-methyl-1-(4-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 25188824 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-methyl-1-(4-nitrophenyl)-7-(trifluoromethyl)-2,3-dihydroindole |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2)c2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O2/c1-10-9-20(11-5-7-12(8-6-11)21(22)23)15-13(10)3-2-4-14(15)16(17,18)19/h2-8,10H,9H2,1H3 |
| InChIKey | JOZJLQKCYSTOTD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|