C19H16N2O2 — CID 25188544
3-methyl-1-(4-nitrophenyl)-2,3-dihydrobenzo[g]indole (PubChem CID 25188544) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-methyl-1-(4-nitrophenyl)-2,3-dihydrobenzo[g]indole.
| Compound Name | 3-methyl-1-(4-nitrophenyl)-2,3-dihydrobenzo[g]indole |
|---|---|
| PubChem CID | 25188544 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-methyl-1-(4-nitrophenyl)-2,3-dihydrobenzo[g]indole |
| SMILES | CC1CN(c2ccc([N+](=O)[O-])cc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C19H16N2O2/c1-13-12-20(15-7-9-16(10-8-15)21(22)23)19-17(13)11-6-14-4-2-3-5-18(14)19/h2-11,13H,12H2,1H3 |
| InChIKey | LGQIZBOYXAKWKT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|