C20H20N2O2 — CID 917143
(9R)-9,11,11-trimethyl-3-(4-nitrophenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene (PubChem CID 917143) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (9R)-9,11,11-trimethyl-3-(4-nitrophenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene.
| Compound Name | (9R)-9,11,11-trimethyl-3-(4-nitrophenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 917143 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (9R)-9,11,11-trimethyl-3-(4-nitrophenyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene |
| SMILES | C[C@@H]1CC(C)(C)n2cc(-c3ccc([N+](=O)[O-])cc3)c3cccc1c32 |
| InChI | InChI=1S/C20H20N2O2/c1-13-11-20(2,3)21-12-18(17-6-4-5-16(13)19(17)21)14-7-9-15(10-8-14)22(23)24/h4-10,12-13H,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | CDJZBNLNZJQXBJ-CYBMUJFWSA-N |
| XLogP | 5.46 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|