C19H13Br2N3OS — CID 25189545
3,7-dibromo-5-phenyl-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 25189545) has the molecular formula C19H13Br2N3OS and a molecular weight of 491.21 g/mol. Its IUPAC name is 3,7-dibromo-5-phenyl-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 3,7-dibromo-5-phenyl-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25189545 |
| Molecular Formula | C19H13Br2N3OS |
| Molecular Weight | 491.21 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | 3,7-dibromo-5-phenyl-N-(thiophen-2-ylmethyl)pyrazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | O=C(NCc1cccs1)c1nn2c(Br)cc(-c3ccccc3)cc2c1Br |
| InChI | InChI=1S/C19H13Br2N3OS/c20-16-10-13(12-5-2-1-3-6-12)9-15-17(21)18(23-24(15)16)19(25)22-11-14-7-4-8-26-14/h1-10H,11H2,(H,22,25) |
| InChIKey | XTEHJCOKYPNNHC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|