C14H15ClFN3OS — CID 25190403
4-tert-butyl-N-[(2-chloro-6-fluorophenyl)methyl]thiadiazole-5-carboxamide (PubChem CID 25190403) has the molecular formula C14H15ClFN3OS and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2-chloro-6-fluorophenyl)methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[(2-chloro-6-fluorophenyl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 25190403 |
| Molecular Formula | C14H15ClFN3OS |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-tert-butyl-N-[(2-chloro-6-fluorophenyl)methyl]thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H15ClFN3OS/c1-14(2,3)12-11(21-19-18-12)13(20)17-7-8-9(15)5-4-6-10(8)16/h4-6H,7H2,1-3H3,(H,17,20) |
| InChIKey | FMHDRBNUWRXOQS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |