C35H47F2N5O4 — CID 25191569
3-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-1-ethyl-5-N-hexyl-5-N-methylpyrazole-3,5-dicarboxamide (PubChem CID 25191569) has the molecular formula C35H47F2N5O4 and a molecular weight of 639.79 g/mol. Its IUPAC name is 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-1-ethyl-5-N-hexyl-5-N-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-1-ethyl-5-N-hexyl-5-N-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 25191569 |
| Molecular Formula | C35H47F2N5O4 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(1S)-7-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butan-2-yl]-1-ethyl-5-N-hexyl-5-N-methylpyrazole-3,5-dicarboxamide |
| SMILES | CCCCCCN(C)C(=O)c1cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CN[C@H]2CCCc3ccc(OC)cc32)nn1CC |
| InChI | InChI=1S/C35H47F2N5O4/c1-5-7-8-9-15-41(3)35(45)32-21-31(40-42(32)6-2)34(44)39-30(18-23-16-25(36)19-26(37)17-23)33(43)22-38-29-12-10-11-24-13-14-27(46-4)20-28(24)29/h13-14,16-17,19-21,29-30,33,38,43H,5-12,15,18,22H2,1-4H3,(H,39,44)/t29-,30-,33+/m0/s1 |
| InChIKey | FRUJREXKFADQOR-WSZLSEGOSA-N |
| XLogP | 5.21 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|