C27H37FN2O4S — CID 25196089
(3S,4S,5R)-3-[(4-amino-3-cyclobutyloxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 25196089) has the molecular formula C27H37FN2O4S and a molecular weight of 504.67 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-cyclobutyloxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-cyclobutyloxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 25196089 |
| Molecular Formula | C27H37FN2O4S |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-cyclobutyloxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3cc(F)c(N)c(OC4CCC4)c3)[C@@H]2O)c1 |
| InChI | InChI=1S/C27H37FN2O4S/c1-27(2,3)20-7-4-6-17(11-20)14-30-23-16-35(32,33)15-19(26(23)31)10-18-12-22(28)25(29)24(13-18)34-21-8-5-9-21/h4,6-7,11-13,19,21,23,26,30-31H,5,8-10,14-16,29H2,1-3H3/t19-,23+,26+/m1/s1 |
| InChIKey | SFTUXQRUOWDWQS-BLFHIAQRSA-N |
| XLogP | 3.74 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|