C28H38F4N2O4S — CID 66649674
(1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[(1R)-1-(3-tert-butylphenyl)ethyl]amino]-1-oxothian-4-ol (PubChem CID 66649674) has the molecular formula C28H38F4N2O4S and a molecular weight of 574.68 g/mol. Its IUPAC name is (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[(1R)-1-(3-tert-butylphenyl)ethyl]amino]-1-oxothian-4-ol.
| Compound Name | (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[(1R)-1-(3-tert-butylphenyl)ethyl]amino]-1-oxothian-4-ol |
|---|---|
| PubChem CID | 66649674 |
| Molecular Formula | C28H38F4N2O4S |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | (1R,3S,4S,5R)-3-[[4-amino-3-fluoro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]-5-[[(1R)-1-(3-tert-butylphenyl)ethyl]amino]-1-oxothian-4-ol |
| SMILES | COC[C@@H](Oc1cc(C[C@@H]2C[S@@](=O)C[C@H](N[C@H](C)c3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1N)C(F)(F)F |
| InChI | InChI=1S/C28H38F4N2O4S/c1-16(18-7-6-8-20(12-18)27(2,3)4)34-22-15-39(36)14-19(26(22)35)9-17-10-21(29)25(33)23(11-17)38-24(13-37-5)28(30,31)32/h6-8,10-12,16,19,22,24,26,34-35H,9,13-15,33H2,1-5H3/t16-,19-,22+,24-,26+,39-/m1/s1 |
| InChIKey | JZTFFTMPOGLVCG-CBZQJITBSA-N |
| XLogP | 4.66 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|