C15H12N2O5 — CID 25196349
N-(3,4-dihydroxy-9-oxa-10-azatricyclo[6.1.1.02,7]deca-2(7),3,5-trien-10-yl)-2-hydroxybenzamide (PubChem CID 25196349) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(3,4-dihydroxy-9-oxa-10-azatricyclo[6.1.1.02,7]deca-2(7),3,5-trien-10-yl)-2-hydroxybenzamide.
| Compound Name | N-(3,4-dihydroxy-9-oxa-10-azatricyclo[6.1.1.02,7]deca-2(7),3,5-trien-10-yl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 25196349 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(3,4-dihydroxy-9-oxa-10-azatricyclo[6.1.1.02,7]deca-2(7),3,5-trien-10-yl)-2-hydroxybenzamide |
| SMILES | O=C(NN1C2OC1c1c2ccc(O)c1O)c1ccccc1O |
| InChI | InChI=1S/C15H12N2O5/c18-9-4-2-1-3-7(9)13(21)16-17-14-8-5-6-10(19)12(20)11(8)15(17)22-14/h1-6,14-15,18-20H,(H,16,21) |
| InChIKey | XDRJSNITEZCFSR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|