C21H23Br2N5O3S — CID 25196692
1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(3,5-dimethylphenyl)urea (PubChem CID 25196692) has the molecular formula C21H23Br2N5O3S and a molecular weight of 585.32 g/mol. Its IUPAC name is 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 25196692 |
| Molecular Formula | C21H23Br2N5O3S |
| Molecular Weight | 585.32 g/mol |
| Exact Mass | 582.99 |
| IUPAC Name | 1-[[(2R,4R)-1-cyano-4-[(2,5-dibromophenyl)sulfonylamino]pyrrolidin-2-yl]methyl]-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NC[C@H]2C[C@@H](NS(=O)(=O)c3cc(Br)ccc3Br)CN2C#N)c1 |
| InChI | InChI=1S/C21H23Br2N5O3S/c1-13-5-14(2)7-16(6-13)26-21(29)25-10-18-9-17(11-28(18)12-24)27-32(30,31)20-8-15(22)3-4-19(20)23/h3-8,17-18,27H,9-11H2,1-2H3,(H2,25,26,29)/t17-,18-/m1/s1 |
| InChIKey | GWNARJIGKAYOGU-QZTJIDSGSA-N |
| XLogP | 3.85 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|