C18H17NO3 — CID 25196697
2-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]-4,5-dihydroxy-3H-isoindol-1-one (PubChem CID 25196697) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]-4,5-dihydroxy-3H-isoindol-1-one.
| Compound Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]-4,5-dihydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 25196697 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[[(1R)-2,3-dihydro-1H-inden-1-yl]methyl]-4,5-dihydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2ccc(O)c(O)c2CN1C[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C18H17NO3/c20-16-8-7-14-15(17(16)21)10-19(18(14)22)9-12-6-5-11-3-1-2-4-13(11)12/h1-4,7-8,12,20-21H,5-6,9-10H2/t12-/m0/s1 |
| InChIKey | OZXPQNVLHDAFML-LBPRGKRZSA-N |
| XLogP | 2.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|