C12H16HgNO6 — CID 25199594
[3-[[2-(carboxymethoxy)benzoyl]amino]-2-hydroxypropyl]mercury;hydrate (PubChem CID 25199594) has the molecular formula C12H16HgNO6 and a molecular weight of 470.85 g/mol. Its IUPAC name is [3-[[2-(carboxymethoxy)benzoyl]amino]-2-hydroxypropyl]mercury;hydrate.
| Compound Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-hydroxypropyl]mercury;hydrate |
|---|---|
| PubChem CID | 25199594 |
| Molecular Formula | C12H16HgNO6 |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-hydroxypropyl]mercury;hydrate |
| SMILES | O.O=C(O)COc1ccccc1C(=O)NCC(O)C[Hg] |
| InChI | InChI=1S/C12H14NO5.Hg.H2O/c1-8(14)6-13-12(17)9-4-2-3-5-10(9)18-7-11(15)16;;/h2-5,8,14H,1,6-7H2,(H,13,17)(H,15,16);;1H2 |
| InChIKey | TZMZETMOJSVOIQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|