C13H15HgNNaO5 — CID 175845123
sodium [3-[[2-(carboxylatomethoxy)benzoyl]amino]-2-methoxypropyl]mercury (PubChem CID 175845123) has the molecular formula C13H15HgNNaO5 and a molecular weight of 488.85 g/mol. Its IUPAC name is sodium [3-[[2-(carboxylatomethoxy)benzoyl]amino]-2-methoxypropyl]mercury.
| Compound Name | sodium [3-[[2-(carboxylatomethoxy)benzoyl]amino]-2-methoxypropyl]mercury |
|---|---|
| PubChem CID | 175845123 |
| Molecular Formula | C13H15HgNNaO5 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | sodium [3-[[2-(carboxylatomethoxy)benzoyl]amino]-2-methoxypropyl]mercury |
| SMILES | COC(C[Hg])CNC(=O)c1ccccc1OCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H16NO5.Hg.Na/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);;/q;;+1/p-1 |
| InChIKey | YQZVCVFBCWNKAQ-UHFFFAOYSA-M |
| XLogP | -3.47 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|