C13H16HgNO5+ — CID 6455484
[3-[[2-(carboxymethoxy)benzoyl]amino]-2-methoxypropyl]mercury(1+) (PubChem CID 6455484) has the molecular formula C13H16HgNO5+ and a molecular weight of 466.86 g/mol. Its IUPAC name is [3-[[2-(carboxymethoxy)benzoyl]amino]-2-methoxypropyl]mercury(1+).
| Compound Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-methoxypropyl]mercury(1+) |
|---|---|
| PubChem CID | 6455484 |
| Molecular Formula | C13H16HgNO5+ |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-methoxypropyl]mercury(1+) |
| SMILES | COC(C[Hg+])CNC(=O)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C13H16NO5.Hg/c1-9(18-2)7-14-13(17)10-5-3-4-6-11(10)19-8-12(15)16;/h3-6,9H,1,7-8H2,2H3,(H,14,17)(H,15,16);/q;+1 |
| InChIKey | VTCIJZPATSUMJC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|