C15H20HgNO6+ — CID 23182615
[3-[[2-(carboxymethoxy)benzoyl]amino]-2-(2-methoxyethoxy)propyl]mercury(1+) (PubChem CID 23182615) has the molecular formula C15H20HgNO6+ and a molecular weight of 510.92 g/mol. Its IUPAC name is [3-[[2-(carboxymethoxy)benzoyl]amino]-2-(2-methoxyethoxy)propyl]mercury(1+).
| Compound Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-(2-methoxyethoxy)propyl]mercury(1+) |
|---|---|
| PubChem CID | 23182615 |
| Molecular Formula | C15H20HgNO6+ |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | [3-[[2-(carboxymethoxy)benzoyl]amino]-2-(2-methoxyethoxy)propyl]mercury(1+) |
| SMILES | COCCOC(C[Hg+])CNC(=O)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C15H20NO6.Hg/c1-11(21-8-7-20-2)9-16-15(19)12-5-3-4-6-13(12)22-10-14(17)18;/h3-6,11H,1,7-10H2,2H3,(H,16,19)(H,17,18);/q;+1 |
| InChIKey | HOYXNJIDDSNBQN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|