ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid

C12H23O3P — CID 25215582

IUPACethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid
SMILESCCCCC(=C=C(C)CC)P(=O)(O)OCC
InChIInChI=1S/C12H23O3P/c1-5-8-9-12(10-11(4)6-2)16(13,14)15-7-3/h5-9H2,1-4H3,(H,13,14)
InChIKeyJWXLOQHFBUVWOM-UHFFFAOYSA-N
MW246.29 g/mol
LogP4.24
Rot. Bonds7

About ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid

ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid (PubChem CID 25215582) has the molecular formula C12H23O3P and a molecular weight of 246.29 g/mol. Its IUPAC name is ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid.

Molecular Properties

Compound Nameethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid
PubChem CID25215582
Molecular FormulaC12H23O3P
Molecular Weight246.29 g/mol
Exact Mass246.14
IUPAC Nameethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid
SMILESCCCCC(=C=C(C)CC)P(=O)(O)OCC
InChIInChI=1S/C12H23O3P/c1-5-8-9-12(10-11(4)6-2)16(13,14)15-7-3/h5-9H2,1-4H3,(H,13,14)
InChIKeyJWXLOQHFBUVWOM-UHFFFAOYSA-N
XLogP4.24
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.29
LogP ≤ 54.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid?
The IUPAC name of ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid (CID 25215582) is ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid.
What is the SMILES notation for ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid?
The canonical SMILES for ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid is CCCCC(=C=C(C)CC)P(=O)(O)OCC.
What is the InChIKey of ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid?
The InChIKey is JWXLOQHFBUVWOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23O3P/c1-5-8-9-12(10-11(4)6-2)16(13,14)15-7-3/h5-9H2,1-4H3,(H,13,14).
What are the key properties of ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid?
ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid has a molecular weight of 246.29 g/mol, XLogP of 4.24, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid is sourced from PubChem (CID 25215582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).