C12H23O3P — CID 25215582
ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid (PubChem CID 25215582) has the molecular formula C12H23O3P and a molecular weight of 246.29 g/mol. Its IUPAC name is ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid.
| Compound Name | ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid |
|---|---|
| PubChem CID | 25215582 |
| Molecular Formula | C12H23O3P |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | ethoxy(3-methylnona-3,4-dien-5-yl)phosphinic acid |
| SMILES | CCCCC(=C=C(C)CC)P(=O)(O)OCC |
| InChI | InChI=1S/C12H23O3P/c1-5-8-9-12(10-11(4)6-2)16(13,14)15-7-3/h5-9H2,1-4H3,(H,13,14) |
| InChIKey | JWXLOQHFBUVWOM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|