C16H31O5P — CID 10592829
4-diethoxyphosphoryl-1-(1-ethoxyethoxy)-2-methylhepta-2,3-diene (PubChem CID 10592829) has the molecular formula C16H31O5P and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-1-(1-ethoxyethoxy)-2-methylhepta-2,3-diene.
| Compound Name | 4-diethoxyphosphoryl-1-(1-ethoxyethoxy)-2-methylhepta-2,3-diene |
|---|---|
| PubChem CID | 10592829 |
| Molecular Formula | C16H31O5P |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-diethoxyphosphoryl-1-(1-ethoxyethoxy)-2-methylhepta-2,3-diene |
| SMILES | CCCC(=C=C(C)COC(C)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H31O5P/c1-7-11-16(22(17,20-9-3)21-10-4)12-14(5)13-19-15(6)18-8-2/h15H,7-11,13H2,1-6H3 |
| InChIKey | CPOWPVRHTNEAOK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|