C14H27O6P — CID 100942270
4-diethoxyphosphoryl-5-(1-ethoxyethoxy)-2-methylpenta-2,3-dien-1-ol (PubChem CID 100942270) has the molecular formula C14H27O6P and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-5-(1-ethoxyethoxy)-2-methylpenta-2,3-dien-1-ol.
| Compound Name | 4-diethoxyphosphoryl-5-(1-ethoxyethoxy)-2-methylpenta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 100942270 |
| Molecular Formula | C14H27O6P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-diethoxyphosphoryl-5-(1-ethoxyethoxy)-2-methylpenta-2,3-dien-1-ol |
| SMILES | CCOC(C)OCC(=C=C(C)CO)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H27O6P/c1-6-17-13(5)18-11-14(9-12(4)10-15)21(16,19-7-2)20-8-3/h13,15H,6-8,10-11H2,1-5H3 |
| InChIKey | VVBLKSLWMOOMDU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|