C11H21O5P — CID 10754076
4-diethoxyphosphoryl-5-methoxy-2-methylpenta-2,3-dien-1-ol (PubChem CID 10754076) has the molecular formula C11H21O5P and a molecular weight of 264.26 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-5-methoxy-2-methylpenta-2,3-dien-1-ol.
| Compound Name | 4-diethoxyphosphoryl-5-methoxy-2-methylpenta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 10754076 |
| Molecular Formula | C11H21O5P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-diethoxyphosphoryl-5-methoxy-2-methylpenta-2,3-dien-1-ol |
| SMILES | CCOP(=O)(OCC)C(=C=C(C)CO)COC |
| InChI | InChI=1S/C11H21O5P/c1-5-15-17(13,16-6-2)11(9-14-4)7-10(3)8-12/h12H,5-6,8-9H2,1-4H3 |
| InChIKey | KQEKPRCYCAAPFK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|