C34H44N4O6 — CID 25215772
tert-butyl N-[(1S)-2-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-2-oxo-1-phenylethyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 25215772) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-2-oxo-1-phenylethyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-2-oxo-1-phenylethyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 25215772 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-2-oxo-1-phenylethyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@H](C(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H44N4O6/c1-31(2,3)43-29(41)35-36(30(42)44-32(4,5)6)26(22-15-11-9-12-16-22)27(39)38-25-21-23-19-20-34(25,33(23,7)8)28(40)37(38)24-17-13-10-14-18-24/h9-18,23,25-26H,19-21H2,1-8H3,(H,35,41)/t23-,25-,26+,34+/m1/s1 |
| InChIKey | IADZPXGZRPSXRT-TVSJJYGASA-N |
| XLogP | 6.39 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|