C25H33ClN2O4 — CID 25215830
tert-butyl N-[(2R)-2-(2-chlorophenyl)-2-[(1R,2S,5R,8S)-1,11,11-trimethyl-4-oxo-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-5-yl]ethyl]carbamate (PubChem CID 25215830) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(2-chlorophenyl)-2-[(1R,2S,5R,8S)-1,11,11-trimethyl-4-oxo-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(2-chlorophenyl)-2-[(1R,2S,5R,8S)-1,11,11-trimethyl-4-oxo-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 25215830 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | tert-butyl N-[(2R)-2-(2-chlorophenyl)-2-[(1R,2S,5R,8S)-1,11,11-trimethyl-4-oxo-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](c1ccccc1Cl)[C@H]1N=C2[C@H]3CC[C@@](C)([C@@H]2OC1=O)C3(C)C |
| InChI | InChI=1S/C25H33ClN2O4/c1-23(2,3)32-22(30)27-13-15(14-9-7-8-10-17(14)26)18-21(29)31-20-19(28-18)16-11-12-25(20,6)24(16,4)5/h7-10,15-16,18,20H,11-13H2,1-6H3,(H,27,30)/t15-,16+,18+,20+,25-/m0/s1 |
| InChIKey | UPGQGSWCPVZBOH-QZUQGSQGSA-N |
| XLogP | 5.14 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |