C24H33N7O3 — CID 25221126
N-[4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]phenyl]acetamide (PubChem CID 25221126) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 25221126 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[4-[[2-butoxy-6-(2-morpholin-4-ylethylamino)purin-9-yl]methyl]phenyl]acetamide |
| SMILES | CCCCOc1nc(NCCN2CCOCC2)c2ncn(Cc3ccc(NC(C)=O)cc3)c2n1 |
| InChI | InChI=1S/C24H33N7O3/c1-3-4-13-34-24-28-22(25-9-10-30-11-14-33-15-12-30)21-23(29-24)31(17-26-21)16-19-5-7-20(8-6-19)27-18(2)32/h5-8,17H,3-4,9-16H2,1-2H3,(H,27,32)(H,25,28,29) |
| InChIKey | ZGSSCWCQPFCWPB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|