C26H38N6O2 — CID 25221240
2-butoxy-N-(2-morpholin-4-ylethyl)-9-[(2,3,5,6-tetramethylphenyl)methyl]purin-6-amine (PubChem CID 25221240) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-butoxy-N-(2-morpholin-4-ylethyl)-9-[(2,3,5,6-tetramethylphenyl)methyl]purin-6-amine.
| Compound Name | 2-butoxy-N-(2-morpholin-4-ylethyl)-9-[(2,3,5,6-tetramethylphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 25221240 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-butoxy-N-(2-morpholin-4-ylethyl)-9-[(2,3,5,6-tetramethylphenyl)methyl]purin-6-amine |
| SMILES | CCCCOc1nc(NCCN2CCOCC2)c2ncn(Cc3c(C)c(C)cc(C)c3C)c2n1 |
| InChI | InChI=1S/C26H38N6O2/c1-6-7-12-34-26-29-24(27-8-9-31-10-13-33-14-11-31)23-25(30-26)32(17-28-23)16-22-20(4)18(2)15-19(3)21(22)5/h15,17H,6-14,16H2,1-5H3,(H,27,29,30) |
| InChIKey | VOAVSHMAEFGHIE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|