C23H33N7O3 — CID 25222578
9-[(5-amino-2-methoxyphenyl)methyl]-2-butoxy-N-(2-morpholin-4-ylethyl)purin-6-amine (PubChem CID 25222578) has the molecular formula C23H33N7O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 9-[(5-amino-2-methoxyphenyl)methyl]-2-butoxy-N-(2-morpholin-4-ylethyl)purin-6-amine.
| Compound Name | 9-[(5-amino-2-methoxyphenyl)methyl]-2-butoxy-N-(2-morpholin-4-ylethyl)purin-6-amine |
|---|---|
| PubChem CID | 25222578 |
| Molecular Formula | C23H33N7O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 9-[(5-amino-2-methoxyphenyl)methyl]-2-butoxy-N-(2-morpholin-4-ylethyl)purin-6-amine |
| SMILES | CCCCOc1nc(NCCN2CCOCC2)c2ncn(Cc3cc(N)ccc3OC)c2n1 |
| InChI | InChI=1S/C23H33N7O3/c1-3-4-11-33-23-27-21(25-7-8-29-9-12-32-13-10-29)20-22(28-23)30(16-26-20)15-17-14-18(24)5-6-19(17)31-2/h5-6,14,16H,3-4,7-13,15,24H2,1-2H3,(H,25,27,28) |
| InChIKey | FVXSSHRKRVFSDE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|