C13H9F3N2O3S — CID 25225801
N'-[3-(trifluoromethoxy)benzoyl]thiophene-2-carbohydrazide (PubChem CID 25225801) has the molecular formula C13H9F3N2O3S and a molecular weight of 330.29 g/mol. Its IUPAC name is N'-[3-(trifluoromethoxy)benzoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(trifluoromethoxy)benzoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 25225801 |
| Molecular Formula | C13H9F3N2O3S |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N'-[3-(trifluoromethoxy)benzoyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H9F3N2O3S/c14-13(15,16)21-9-4-1-3-8(7-9)11(19)17-18-12(20)10-5-2-6-22-10/h1-7H,(H,17,19)(H,18,20) |
| InChIKey | RHCFCTCYUWCNKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|