C17H12F3N3O2S — CID 122163086
N-[(3-thiophen-2-ylpyrazin-2-yl)methyl]-3-(trifluoromethoxy)benzamide (PubChem CID 122163086) has the molecular formula C17H12F3N3O2S and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[(3-thiophen-2-ylpyrazin-2-yl)methyl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[(3-thiophen-2-ylpyrazin-2-yl)methyl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122163086 |
| Molecular Formula | C17H12F3N3O2S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(3-thiophen-2-ylpyrazin-2-yl)methyl]-3-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCc1nccnc1-c1cccs1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3O2S/c18-17(19,20)25-12-4-1-3-11(9-12)16(24)23-10-13-15(22-7-6-21-13)14-5-2-8-26-14/h1-9H,10H2,(H,23,24) |
| InChIKey | IMCSERSMNAGCOY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |