C29H54O13 — CID 25231774
methyl (3S,12S)-3-hydroxy-12-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxyhexadecanoate (PubChem CID 25231774) has the molecular formula C29H54O13 and a molecular weight of 610.74 g/mol. Its IUPAC name is methyl (3S,12S)-3-hydroxy-12-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxyhexadecanoate.
| Compound Name | methyl (3S,12S)-3-hydroxy-12-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxyhexadecanoate |
|---|---|
| PubChem CID | 25231774 |
| Molecular Formula | C29H54O13 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.36 |
| IUPAC Name | methyl (3S,12S)-3-hydroxy-12-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxyhexadecanoate |
| SMILES | CCCC[C@@H](CCCCCCCC[C@H](O)CC(=O)OC)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C29H54O13/c1-4-5-13-19(14-11-9-7-6-8-10-12-18(30)15-21(31)38-3)41-29-27(37)25(35)23(33)20(42-29)16-39-28-26(36)24(34)22(32)17(2)40-28/h17-20,22-30,32-37H,4-16H2,1-3H3/t17-,18-,19-,20+,22-,23+,24+,25-,26+,27+,28+,29+/m0/s1 |
| InChIKey | ACSIVUBQQIEISO-INRARKSQSA-N |
| XLogP | 0.26 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|