C19H36O7 — CID 121326886
4-hydroxy-8-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxytridecan-2-one (PubChem CID 121326886) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-hydroxy-8-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxytridecan-2-one.
| Compound Name | 4-hydroxy-8-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxytridecan-2-one |
|---|---|
| PubChem CID | 121326886 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 4-hydroxy-8-[(3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxytridecan-2-one |
| SMILES | CCCCCC(CCCC(O)CC(C)=O)OC1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H36O7/c1-4-5-6-9-15(10-7-8-14(21)11-12(2)20)26-19-18(24)17(23)16(22)13(3)25-19/h13-19,21-24H,4-11H2,1-3H3/t13-,14?,15?,16+,17+,18-,19?/m0/s1 |
| InChIKey | KEGQEDODOWXGOO-DNLMIIRRSA-N |
| XLogP | 1.29 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|