C18H26O6 — CID 25232648
(5S)-4-(methoxymethoxy)-5-(oxan-2-yloxymethyl)-3,5-bis(prop-2-enyl)furan-2-one (PubChem CID 25232648) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (5S)-4-(methoxymethoxy)-5-(oxan-2-yloxymethyl)-3,5-bis(prop-2-enyl)furan-2-one.
| Compound Name | (5S)-4-(methoxymethoxy)-5-(oxan-2-yloxymethyl)-3,5-bis(prop-2-enyl)furan-2-one |
|---|---|
| PubChem CID | 25232648 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (5S)-4-(methoxymethoxy)-5-(oxan-2-yloxymethyl)-3,5-bis(prop-2-enyl)furan-2-one |
| SMILES | C=CCC1=C(OCOC)[C@](CC=C)(COC2CCCCO2)OC1=O |
| InChI | InChI=1S/C18H26O6/c1-4-8-14-16(23-13-20-3)18(10-5-2,24-17(14)19)12-22-15-9-6-7-11-21-15/h4-5,15H,1-2,6-13H2,3H3/t15?,18-/m0/s1 |
| InChIKey | XRMSNFRCQHAXNQ-PKHIMPSTSA-N |
| XLogP | 2.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|