C22H34O6 — CID 25232649
(5S)-4-(methoxymethoxy)-3,5-bis(3-methylbut-2-enyl)-5-(oxan-2-yloxymethyl)furan-2-one (PubChem CID 25232649) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (5S)-4-(methoxymethoxy)-3,5-bis(3-methylbut-2-enyl)-5-(oxan-2-yloxymethyl)furan-2-one.
| Compound Name | (5S)-4-(methoxymethoxy)-3,5-bis(3-methylbut-2-enyl)-5-(oxan-2-yloxymethyl)furan-2-one |
|---|---|
| PubChem CID | 25232649 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (5S)-4-(methoxymethoxy)-3,5-bis(3-methylbut-2-enyl)-5-(oxan-2-yloxymethyl)furan-2-one |
| SMILES | COCOC1=C(CC=C(C)C)C(=O)O[C@@]1(CC=C(C)C)COC1CCCCO1 |
| InChI | InChI=1S/C22H34O6/c1-16(2)9-10-18-20(27-15-24-5)22(28-21(18)23,12-11-17(3)4)14-26-19-8-6-7-13-25-19/h9,11,19H,6-8,10,12-15H2,1-5H3/t19?,22-/m0/s1 |
| InChIKey | APTNORCGNAEQMG-BPARTEKVSA-N |
| XLogP | 4.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|